Drugs present in MMsINC which are similar to the molecule MMscode: MMs01182528
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727043![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.74 |
MMs01727049![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.74 |
MMs01727047![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.74 |
MMs01727045![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.74 |
MMs01727204![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.72 |
MMs01727198![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.72 |
MMs01727200![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.72 |
MMs01727202![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.72 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |
MMs01725015![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |