Drugs present in MMsINC which are similar to the molecule MMscode: MMs01160398
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727235 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727233 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727239 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727237 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01725288 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01727022 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(S(=O)(=O)C)C1=O)c1ccccc1 | 0.70 |
MMs01727020 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(S(=O)(=O)C)C1=O)c1ccccc1 | 0.70 |
MMs01727018 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(S(=O)(=O)C)C1=O)c1ccccc1 | 0.70 |
MMs01727016 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(S(=O)(=O)C)C1=O)c1ccccc1 | 0.70 |