Drugs present in MMsINC which are similar to the molecule MMscode: MMs01160269
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.75 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.71 |
MMs01725141 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.71 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.70 |