Drugs present in MMsINC which are similar to the molecule MMscode: MMs01151600
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724937![]() | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.83 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.75 |
MMs01724864![]() | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.73 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01725288![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01724922![]() | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.70 |