Drugs present in MMsINC which are similar to the molecule MMscode: MMs01138015
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.79 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.79 |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.74 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.71 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.71 |
MMs01725625 | Clc1ccc(cc1)C(=O)CN(CCCN1c2c(CCc3c1cccc3)cccc2)C | 0.71 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.70 |
MMs01725141 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.70 |
MMs01726917 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.70 |