Drugs present in MMsINC which are similar to the molecule MMscode: MMs01118380
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726510 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.74 |
MMs01726512 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.74 |
MMs01726514 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.74 |
MMs01726516 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.74 |
MMs01725357 | S1(=O)(=O)C2N(C(C(O)=O)C1(C)C)C(=O)C2 | 0.71 |