Drugs present in MMsINC which are similar to the molecule MMscode: MMs01113615
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.75 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.75 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01726126 | O(CC(O)CNC(C)(C)C)c1c2c(ccc1)C(=O)CCC2 | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |