Drugs present in MMsINC which are similar to the molecule MMscode: MMs01113187
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.78 |
MMs01726973 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.78 |
MMs01726971 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.78 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.76 |
MMs01725219 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.76 |
MMs01725623 | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.73 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725929 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.71 |