Drugs present in MMsINC which are similar to the molecule MMscode: MMs01106862
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.73 |
MMs01724810![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.72 |
MMs01725059![]() | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01725173![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.71 |
MMs01725165![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.71 |
MMs01724864![]() | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.70 |