Drugs present in MMsINC which are similar to the molecule MMscode: MMs01100655
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.79 |
MMs01725723![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.75 |
MMs01726749![]() | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.72 |
MMs01726462![]() | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.72 |
MMs01725857![]() | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.72 |
MMs01727086![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.71 |
MMs01725534![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.71 |
MMs01727082![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.71 |
MMs01727084![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.71 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.71 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |