Drugs present in MMsINC which are similar to the molecule MMscode: MMs01095190
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726303 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.74 |
MMs01726309 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.74 |
MMs01726307 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.74 |
MMs01726305 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.74 |
MMs01726393 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726387 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726389 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726391 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01725609 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |