Drugs present in MMsINC which are similar to the molecule MMscode: MMs01086556
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.81 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.80 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.79 |
MMs01725524 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.74 |
MMs01725525 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.74 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.73 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.72 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |