Drugs present in MMsINC which are similar to the molecule MMscode: MMs01079325
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.74 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.71 |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.71 |
MMs01725170 | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.71 |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.70 |