Drugs present in MMsINC which are similar to the molecule MMscode: MMs01079192
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725349 | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.72 |
MMs01725351 | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.72 |
MMs01725353 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |
MMs01725355 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.70 |