Drugs present in MMsINC which are similar to the molecule MMscode: MMs01063181
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724907 | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.79 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.79 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.73 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.72 |
MMs01725213 | Fc1ccc(cc1)Cn1c2c(nc1NC1CCN(CC1)CCc1ccc(OC)cc1)cccc2 | 0.71 |
MMs01726906 | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.71 |
MMs01726908 | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.71 |
MMs01724991 | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.70 |