Drugs present in MMsINC which are similar to the molecule MMscode: MMs01050130
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724897 | o1nc(cc1C)C(=O)NNCc1ccccc1 | 0.73 |
MMs01725159 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)CCNC(=O)c1noc(c1)C | 0.71 |
MMs01725607 | Clc1cccc(F)c1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.70 |
MMs01726751 | Clc1cccc(F)c1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.70 |
MMs01726753 | Clc1cccc(F)c1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.70 |
MMs01726755 | Clc1cccc(F)c1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.70 |