Drugs present in MMsINC which are similar to the molecule MMscode: MMs01014295
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.75 |
MMs01725413![]() | S(=O)(Cc1ncc(C)c(OC)c1C)c1[nH]c2c(n1)cc(OC)cc2 | 0.74 |
MMs01725449![]() | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.73 |
MMs01725790![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.72 |
MMs01725205![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.71 |
MMs01725422![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.71 |








