Drugs present in MMsINC which are similar to the molecule MMscode: MMs01005145
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724790 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.74 |
MMs01727717 | OC1[N+]2(C3C4C(CC2C2N(c5c(C2(C3)C4O)cccc5)C)C1CC)CCC | 0.73 |
MMs01727718 | OC1[N+]2(C3C4C(CC2C2N(c5c(C2(C3)C4O)cccc5)C)C1CC)CCC | 0.73 |
MMs01726777 | Clc1cc2c(N(CCO)C(=O)CN3CCOC23c2ccccc2F)cc1 | 0.72 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |