Drugs present in MMsINC which are similar to the molecule MMscode: MMs00977612
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.78 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.73 |
MMs01727531 | S1c2c(cc(S(=O)(=O)N(C)C)cc2)\C(\c2c1cccc2)=C\CCN1CCN(CC1)C | 0.72 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.71 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |