Drugs present in MMsINC which are similar to the molecule MMscode: MMs00977136
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.84 |
MMs01725217 | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.78 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.75 |
MMs01726498 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.70 |
MMs01726499 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.70 |