Drugs present in MMsINC which are similar to the molecule MMscode: MMs00973360
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.82 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.73 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.73 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.70 |