Drugs present in MMsINC which are similar to the molecule MMscode: MMs00961163
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.73 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.73 |
MMs01725321 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01724810 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01725821 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.71 |
MMs01725621 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.71 |
MMs01726333 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.71 |
MMs01726335 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.71 |
MMs01725059 | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01726915 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.71 |
MMs01725860 | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.70 |
MMs01727208 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.70 |
MMs01727210 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.70 |