Drugs present in MMsINC which are similar to the molecule MMscode: MMs00938621
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.80 |
MMs01725208 | Clc1ccc(cc1)CC1=NN(C2CCCN(CC2)C)C(=O)c2c1cccc2 | 0.78 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.73 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.72 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.72 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.72 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.72 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |