Drugs present in MMsINC which are similar to the molecule MMscode: MMs00934272
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727424 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.77 |
MMs01725811 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.77 |
MMs01725851 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.77 |
MMs01727422 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.77 |
MMs01725176 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.75 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01726815 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726816 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726817 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726814 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.70 |