Drugs present in MMsINC which are similar to the molecule MMscode: MMs00926384
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724897 | o1nc(cc1C)C(=O)NNCc1ccccc1 | 0.74 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.74 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.74 |
MMs01725159 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)CCNC(=O)c1noc(c1)C | 0.74 |
MMs01726749 | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.71 |
MMs01725258 | Clc1cc(C(=O)NC2CCN(CC2)Cc2ccccc2)c(OC)cc1N | 0.71 |