Drugs present in MMsINC which are similar to the molecule MMscode: MMs00917018
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.81 |
MMs01725562 | O1c2c(C(=O)C=C1C(O)=O)c(OCC(O)COc1c3c(OC(=CC3=O)C(O)=O)ccc1)ccc2 | 0.79 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.73 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.73 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.72 |
MMs01725260 | O(C(=O)C)c1ccc(cc1)C(c1ccc(OC(=O)C)cc1)=C1CCCCC1 | 0.72 |