Drugs present in MMsINC which are similar to the molecule MMscode: MMs00915631
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726143 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726139 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01725605 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01726141 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.73 |
MMs01725232 | S(=O)(=O)(Nc1cc2cc([nH]c2cc1)C(=O)N1CCN(CC1)c1ncccc1NC(C)C)C | 0.72 |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.72 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.72 |
MMs01727009 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01725678 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727005 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727007 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01725311 | S(=O)(=O)(NC(=O)c1cc(OC)c(cc1)Cc1c2cc(NC(OC3CCCC3)=O)ccc2n(c1)C)c1ccccc1C | 0.71 |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725701 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725449 | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.71 |