Drugs present in MMsINC which are similar to the molecule MMscode: MMs00903064
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725872![]() | O(CC)c1nc2c(n1Cc1ccc(cc1)-c1ccccc1-c1[nH]nnn1)c(ccc2)C(O)=O | 0.74 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.72 |
MMs01726758![]() | Fc1ccc(cc1)C(=O)c1cc2[nH]c(nc2cc1)NC(OC)=O | 0.72 |
MMs01724881![]() | o1c(c(nc1N(CCO)CCO)-c1ccccc1)-c1ccccc1 | 0.71 |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.71 |
MMs01725422![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.70 |
MMs01725205![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.70 |