Drugs present in MMsINC which are similar to the molecule MMscode: MMs00902492
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.72 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.72 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.71 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.70 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.70 |