Drugs present in MMsINC which are similar to the molecule MMscode: MMs00882654
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.72 |
MMs01725598 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725600 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725697 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725699 | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |