Drugs present in MMsINC which are similar to the molecule MMscode: MMs00836675
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725451 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.77 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.75 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.74 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.71 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |