Drugs present in MMsINC which are similar to the molecule MMscode: MMs00835119
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.80 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.78 |
MMs01725941 | S(=O)(=O)(N)c1cc(cc(NCCCC)c1Oc1ccccc1)C(O)=O | 0.76 |
MMs01725935 | S(=O)(=O)(N)c1cc(cc(N2CCCC2)c1Oc1ccccc1)C(O)=O | 0.73 |
MMs01725623 | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.73 |
MMs01725190 | Clc1cc(O)c(cc1S(=O)(=O)N)C(=O)Nc1c(cccc1C)C | 0.71 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |
MMs01725219 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |