Drugs present in MMsINC which are similar to the molecule MMscode: MMs00832014
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.72 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.72 |
MMs01726905 | Ic1cc(cc(I)c1Oc1cc(I)c(O)cc1)CC(N)C(O)=O | 0.71 |
MMs01725623 | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.71 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.71 |
MMs01726903 | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.70 |
MMs01726904 | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.70 |