Drugs present in MMsINC which are similar to the molecule MMscode: MMs00830309
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.73 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725308![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |
MMs01725018![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |