Drugs present in MMsINC which are similar to the molecule MMscode: MMs00820979
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725317 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.75 |
MMs01724790 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.75 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.73 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725362 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725364 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |