Drugs present in MMsINC which are similar to the molecule MMscode: MMs00802282
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01726551 | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.72 |
MMs01726552 | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.72 |
MMs01726553 | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.72 |
MMs01726554 | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.72 |