Drugs present in MMsINC which are similar to the molecule MMscode: MMs00782659
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725433![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.80 |
MMs01725794![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.80 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.79 |
MMs01725440![]() | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.75 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.72 |
MMs01725393![]() | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01726924![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.72 |
MMs01725221![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.72 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01725632![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01724845![]() | Brc1ccccc1C[N+](CC)(C)C | 0.71 |
MMs01725575![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.71 |
MMs01725577![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.71 |