Drugs present in MMsINC which are similar to the molecule MMscode: MMs00768831
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725588 | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.72 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.71 |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.71 |
MMs01725286 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.71 |
MMs01727011 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01727012 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01727013 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01727014 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.71 |