Drugs present in MMsINC which are similar to the molecule MMscode: MMs00761241
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.76 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.76 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.76 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.76 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.72 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |