Drugs present in MMsINC which are similar to the molecule MMscode: MMs00754185
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725338 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.72 |