Drugs present in MMsINC which are similar to the molecule MMscode: MMs00733902
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.77 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.76 |
MMs01725329 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.76 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01724951 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01724837 | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.75 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.72 |
MMs01724989 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.71 |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.71 |
MMs01725603 | ClCC\C(=C(/c1ccc(OCCN(C)C)cc1)\c1ccccc1)\c1ccccc1 | 0.71 |