Drugs present in MMsINC which are similar to the molecule MMscode: MMs00724213
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.72 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.70 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.70 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.70 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.70 |