Drugs present in MMsINC which are similar to the molecule MMscode: MMs00719713
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724731![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.81 |
MMs01724951![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.81 |
MMs01724870![]() | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.79 |
MMs01724989![]() | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.79 |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.77 |
MMs01725338![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.74 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.74 |
MMs01725530![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725532![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.72 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |