Drugs present in MMsINC which are similar to the molecule MMscode: MMs00710687
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.79 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.79 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.74 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |