Drugs present in MMsINC which are similar to the molecule MMscode: MMs00704994
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726924![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.81 |
MMs01725221![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.81 |
MMs01725575![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.79 |
MMs01725577![]() | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.79 |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.71 |
MMs01725208![]() | Clc1ccc(cc1)CC1=NN(C2CCCN(CC2)C)C(=O)c2c1cccc2 | 0.70 |