Drugs present in MMsINC which are similar to the molecule MMscode: MMs00694512
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.78 |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.73 |
MMs01727243![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.73 |
MMs01724881![]() | o1c(c(nc1N(CCO)CCO)-c1ccccc1)-c1ccccc1 | 0.73 |
MMs01725261![]() | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.71 |