Drugs present in MMsINC which are similar to the molecule MMscode: MMs00691271
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724837 | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.71 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |
MMs01727198 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727200 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727202 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727204 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |