Drugs present in MMsINC which are similar to the molecule MMscode: MMs00653000
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725870![]() | O1c2c(cc3c(N(CC)C(=CC3=O)C(O)=O)c2CCC)C(=O)C=C1C(O)=O | 0.74 |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.73 |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.71 |
MMs01727511![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.71 |
MMs01725781![]() | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.71 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.71 |
MMs01725723![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.70 |