Drugs present in MMsINC which are similar to the molecule MMscode: MMs00641377
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727610 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.78 |
MMs01727611 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.78 |
MMs01727612 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.78 |
MMs01727613 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.78 |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.71 |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.71 |