Drugs present in MMsINC which are similar to the molecule MMscode: MMs00634424
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.79 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.70 |